About (3R,4E)-3-tert-butyl-4-(2,2-dimethylpropylidene)oxetan-2-one
(3R,4E)-3-tert-butyl-4-(2,2-dimethylpropylidene)oxetan-2-one (PubChem CID 134893054) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is (3R,4E)-3-tert-butyl-4-(2,2-dimethylpropylidene)oxetan-2-one.
Molecular Properties
| Compound Name | (3R,4E)-3-tert-butyl-4-(2,2-dimethylpropylidene)oxetan-2-one |
| PubChem CID | 134893054 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (3R,4E)-3-tert-butyl-4-(2,2-dimethylpropylidene)oxetan-2-one |
| SMILES | CC(C)(C)/C=C1/OC(=O)[C@@H]1C(C)(C)C |
| InChI | InChI=1S/C12H20O2/c1-11(2,3)7-8-9(10(13)14-8)12(4,5)6/h7,9H,1-6H3/b8-7+/t9-/m1/s1 |
| InChIKey | BTPBFEPVFFQWKK-FCZSHJHJSA-N |
| XLogP | 3.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|
Analyze (3R,4E)-3-tert-butyl-4-(2,2-dimethylpropylidene)oxetan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4E)-3-tert-butyl-4-(2,2-dimethylpropylidene)oxetan-2-one?
The IUPAC name of (3R,4E)-3-tert-butyl-4-(2,2-dimethylpropylidene)oxetan-2-one (CID 134893054) is (3R,4E)-3-tert-butyl-4-(2,2-dimethylpropylidene)oxetan-2-one.
What is the SMILES notation for (3R,4E)-3-tert-butyl-4-(2,2-dimethylpropylidene)oxetan-2-one?
The canonical SMILES for (3R,4E)-3-tert-butyl-4-(2,2-dimethylpropylidene)oxetan-2-one is CC(C)(C)/C=C1/OC(=O)[C@@H]1C(C)(C)C.
What is the InChIKey of (3R,4E)-3-tert-butyl-4-(2,2-dimethylpropylidene)oxetan-2-one?
The InChIKey is BTPBFEPVFFQWKK-FCZSHJHJSA-N. The full InChI is InChI=1S/C12H20O2/c1-11(2,3)7-8-9(10(13)14-8)12(4,5)6/h7,9H,1-6H3/b8-7+/t9-/m1/s1.
What are the key properties of (3R,4E)-3-tert-butyl-4-(2,2-dimethylpropylidene)oxetan-2-one?
(3R,4E)-3-tert-butyl-4-(2,2-dimethylpropylidene)oxetan-2-one has a molecular weight of 196.29 g/mol, XLogP of 3.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4E)-3-tert-butyl-4-(2,2-dimethylpropylidene)oxetan-2-one is sourced from PubChem (CID 134893054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).