About (6Z)-8-hydroxy-3-(methoxymethoxy)octa-1,6-dien-1-one
(6Z)-8-hydroxy-3-(methoxymethoxy)octa-1,6-dien-1-one (PubChem CID 134893105) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is (6Z)-8-hydroxy-3-(methoxymethoxy)octa-1,6-dien-1-one.
Molecular Properties
| Compound Name | (6Z)-8-hydroxy-3-(methoxymethoxy)octa-1,6-dien-1-one |
| PubChem CID | 134893105 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (6Z)-8-hydroxy-3-(methoxymethoxy)octa-1,6-dien-1-one |
| SMILES | COCOC(C=C=O)CC/C=C\CO |
| InChI | InChI=1S/C10H16O4/c1-13-9-14-10(6-8-12)5-3-2-4-7-11/h2,4,6,10-11H,3,5,7,9H2,1H3/b4-2- |
| InChIKey | CDEFPXOKHQTUDU-RQOWECAXSA-N |
| XLogP | 0.69 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-8-hydroxy-3-(methoxymethoxy)octa-1,6-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-8-hydroxy-3-(methoxymethoxy)octa-1,6-dien-1-one?
The IUPAC name of (6Z)-8-hydroxy-3-(methoxymethoxy)octa-1,6-dien-1-one (CID 134893105) is (6Z)-8-hydroxy-3-(methoxymethoxy)octa-1,6-dien-1-one.
What is the SMILES notation for (6Z)-8-hydroxy-3-(methoxymethoxy)octa-1,6-dien-1-one?
The canonical SMILES for (6Z)-8-hydroxy-3-(methoxymethoxy)octa-1,6-dien-1-one is COCOC(C=C=O)CC/C=C\CO.
What is the InChIKey of (6Z)-8-hydroxy-3-(methoxymethoxy)octa-1,6-dien-1-one?
The InChIKey is CDEFPXOKHQTUDU-RQOWECAXSA-N. The full InChI is InChI=1S/C10H16O4/c1-13-9-14-10(6-8-12)5-3-2-4-7-11/h2,4,6,10-11H,3,5,7,9H2,1H3/b4-2-.
What are the key properties of (6Z)-8-hydroxy-3-(methoxymethoxy)octa-1,6-dien-1-one?
(6Z)-8-hydroxy-3-(methoxymethoxy)octa-1,6-dien-1-one has a molecular weight of 200.23 g/mol, XLogP of 0.69, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-8-hydroxy-3-(methoxymethoxy)octa-1,6-dien-1-one is sourced from PubChem (CID 134893105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).