C7H9N — CID 134893192
(1S,4S)-bicyclo[2.2.1]hept-5-en-2-imine (PubChem CID 134893192) has the molecular formula C7H9N and a molecular weight of 107.16 g/mol. Its IUPAC name is (1S,4S)-bicyclo[2.2.1]hept-5-en-2-imine.
| Compound Name | (1S,4S)-bicyclo[2.2.1]hept-5-en-2-imine |
|---|---|
| PubChem CID | 134893192 |
| Molecular Formula | C7H9N |
| Molecular Weight | 107.16 g/mol |
| Exact Mass | 107.07 |
| IUPAC Name | (1S,4S)-bicyclo[2.2.1]hept-5-en-2-imine |
| SMILES | [H]/N=C1\C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C7H9N/c8-7-4-5-1-2-6(7)3-5/h1-2,5-6,8H,3-4H2/b8-7+/t5-,6+/m0/s1 |
| InChIKey | ZEKHLDNVBDSKIV-LUSDVDAMSA-N |
| XLogP | 1.60 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 107.16 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|