C8H9F3O2 — CID 134893248
(E)-1,1,1-trifluoro-5-methylhept-5-ene-2,4-dione (PubChem CID 134893248) has the molecular formula C8H9F3O2 and a molecular weight of 194.15 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-5-methylhept-5-ene-2,4-dione.
| Compound Name | (E)-1,1,1-trifluoro-5-methylhept-5-ene-2,4-dione |
|---|---|
| PubChem CID | 134893248 |
| Molecular Formula | C8H9F3O2 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (E)-1,1,1-trifluoro-5-methylhept-5-ene-2,4-dione |
| SMILES | C/C=C(\C)C(=O)CC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H9F3O2/c1-3-5(2)6(12)4-7(13)8(9,10)11/h3H,4H2,1-2H3/b5-3+ |
| InChIKey | SYOKGHPWZCGDRI-HWKANZROSA-N |
| XLogP | 2.04 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|