About 3-[(5-methyl-1H-pyrazol-3-yl)amino]propa-1,2-dien-1-one
3-[(5-methyl-1H-pyrazol-3-yl)amino]propa-1,2-dien-1-one (PubChem CID 134893388) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 3-[(5-methyl-1H-pyrazol-3-yl)amino]propa-1,2-dien-1-one.
Molecular Properties
| Compound Name | 3-[(5-methyl-1H-pyrazol-3-yl)amino]propa-1,2-dien-1-one |
| PubChem CID | 134893388 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 3-[(5-methyl-1H-pyrazol-3-yl)amino]propa-1,2-dien-1-one |
| SMILES | Cc1cc(NC=C=C=O)n[nH]1 |
| InChI | InChI=1S/C7H7N3O/c1-6-5-7(10-9-6)8-3-2-4-11/h3,5H,1H3,(H2,8,9,10) |
| InChIKey | MYEVRKVNVDWGOK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-methyl-1H-pyrazol-3-yl)amino]propa-1,2-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-methyl-1H-pyrazol-3-yl)amino]propa-1,2-dien-1-one?
The IUPAC name of 3-[(5-methyl-1H-pyrazol-3-yl)amino]propa-1,2-dien-1-one (CID 134893388) is 3-[(5-methyl-1H-pyrazol-3-yl)amino]propa-1,2-dien-1-one.
What is the SMILES notation for 3-[(5-methyl-1H-pyrazol-3-yl)amino]propa-1,2-dien-1-one?
The canonical SMILES for 3-[(5-methyl-1H-pyrazol-3-yl)amino]propa-1,2-dien-1-one is Cc1cc(NC=C=C=O)n[nH]1.
What is the InChIKey of 3-[(5-methyl-1H-pyrazol-3-yl)amino]propa-1,2-dien-1-one?
The InChIKey is MYEVRKVNVDWGOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c1-6-5-7(10-9-6)8-3-2-4-11/h3,5H,1H3,(H2,8,9,10).
What are the key properties of 3-[(5-methyl-1H-pyrazol-3-yl)amino]propa-1,2-dien-1-one?
3-[(5-methyl-1H-pyrazol-3-yl)amino]propa-1,2-dien-1-one has a molecular weight of 149.15 g/mol, XLogP of 0.63, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-methyl-1H-pyrazol-3-yl)amino]propa-1,2-dien-1-one is sourced from PubChem (CID 134893388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).