C11H20O2Si — CID 134893398
(2E,4E)-5-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dienal (PubChem CID 134893398) has the molecular formula C11H20O2Si and a molecular weight of 212.37 g/mol. Its IUPAC name is (2E,4E)-5-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dienal.
| Compound Name | (2E,4E)-5-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dienal |
|---|---|
| PubChem CID | 134893398 |
| Molecular Formula | C11H20O2Si |
| Molecular Weight | 212.37 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (2E,4E)-5-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dienal |
| SMILES | CC(C)(C)[Si](C)(C)O/C=C/C=C/C=O |
| InChI | InChI=1S/C11H20O2Si/c1-11(2,3)14(4,5)13-10-8-6-7-9-12/h6-10H,1-5H3/b7-6+,10-8+ |
| InChIKey | PEPYGVNCENWUOQ-LQPGMRSMSA-N |
| XLogP | 3.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|