About 2-[chloro(dimethyl)-λ4-sulfanyl]-1-phenyl-2-trimethylsilylethanone
2-[chloro(dimethyl)-λ4-sulfanyl]-1-phenyl-2-trimethylsilylethanone (PubChem CID 134893448) has the molecular formula C13H21ClOSSi
and a molecular weight of 288.92 g/mol. Its IUPAC name is 2-[chloro(dimethyl)-λ4-sulfanyl]-1-phenyl-2-trimethylsilylethanone.
Molecular Properties
| Compound Name | 2-[chloro(dimethyl)-λ4-sulfanyl]-1-phenyl-2-trimethylsilylethanone |
| PubChem CID | 134893448 |
| Molecular Formula | C13H21ClOSSi |
| Molecular Weight | 288.92 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-[chloro(dimethyl)-λ4-sulfanyl]-1-phenyl-2-trimethylsilylethanone |
| SMILES | C[Si](C)(C)C(C(=O)c1ccccc1)S(C)(C)Cl |
| InChI | InChI=1S/C13H21ClOSSi/c1-16(2,14)13(17(3,4)5)12(15)11-9-7-6-8-10-11/h6-10,13H,1-5H3 |
| InChIKey | XCAWDPAZLTUBMV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.92 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[chloro(dimethyl)-λ4-sulfanyl]-1-phenyl-2-trimethylsilylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[chloro(dimethyl)-λ4-sulfanyl]-1-phenyl-2-trimethylsilylethanone?
The IUPAC name of 2-[chloro(dimethyl)-λ4-sulfanyl]-1-phenyl-2-trimethylsilylethanone (CID 134893448) is 2-[chloro(dimethyl)-λ4-sulfanyl]-1-phenyl-2-trimethylsilylethanone.
What is the SMILES notation for 2-[chloro(dimethyl)-λ4-sulfanyl]-1-phenyl-2-trimethylsilylethanone?
The canonical SMILES for 2-[chloro(dimethyl)-λ4-sulfanyl]-1-phenyl-2-trimethylsilylethanone is C[Si](C)(C)C(C(=O)c1ccccc1)S(C)(C)Cl.
What is the InChIKey of 2-[chloro(dimethyl)-λ4-sulfanyl]-1-phenyl-2-trimethylsilylethanone?
The InChIKey is XCAWDPAZLTUBMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21ClOSSi/c1-16(2,14)13(17(3,4)5)12(15)11-9-7-6-8-10-11/h6-10,13H,1-5H3.
What are the key properties of 2-[chloro(dimethyl)-λ4-sulfanyl]-1-phenyl-2-trimethylsilylethanone?
2-[chloro(dimethyl)-λ4-sulfanyl]-1-phenyl-2-trimethylsilylethanone has a molecular weight of 288.92 g/mol, XLogP of 4.33, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[chloro(dimethyl)-λ4-sulfanyl]-1-phenyl-2-trimethylsilylethanone is sourced from PubChem (CID 134893448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).