C13H20O3 — CID 134893468
(3Z)-2-butyl-3,4-dimethoxyhepta-1,3,6-trien-1-one (PubChem CID 134893468) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (3Z)-2-butyl-3,4-dimethoxyhepta-1,3,6-trien-1-one.
| Compound Name | (3Z)-2-butyl-3,4-dimethoxyhepta-1,3,6-trien-1-one |
|---|---|
| PubChem CID | 134893468 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (3Z)-2-butyl-3,4-dimethoxyhepta-1,3,6-trien-1-one |
| SMILES | C=CC/C(OC)=C(/OC)C(=C=O)CCCC |
| InChI | InChI=1S/C13H20O3/c1-5-7-9-11(10-14)13(16-4)12(15-3)8-6-2/h6H,2,5,7-9H2,1,3-4H3/b13-12- |
| InChIKey | ZGGDUOKOIFYAMQ-SEYXRHQNSA-N |
| XLogP | 3.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|