C9H8Br2O4 — CID 134893578
methyl (1S,4S,6R)-4,7-dibromo-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-6-carboxylate (PubChem CID 134893578) has the molecular formula C9H8Br2O4 and a molecular weight of 339.97 g/mol. Its IUPAC name is methyl (1S,4S,6R)-4,7-dibromo-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-6-carboxylate.
| Compound Name | methyl (1S,4S,6R)-4,7-dibromo-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-6-carboxylate |
|---|---|
| PubChem CID | 134893578 |
| Molecular Formula | C9H8Br2O4 |
| Molecular Weight | 339.97 g/mol |
| Exact Mass | 337.88 |
| IUPAC Name | methyl (1S,4S,6R)-4,7-dibromo-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-6-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@]2(Br)C=C(Br)[C@H]1OC2=O |
| InChI | InChI=1S/C9H8Br2O4/c1-14-7(12)4-2-9(11)3-5(10)6(4)15-8(9)13/h3-4,6H,2H2,1H3/t4-,6+,9+/m1/s1 |
| InChIKey | MOOXAWCWAQUPJT-CJKGYIPXSA-N |
| XLogP | 1.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.97 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|