C9H20ClN3 — CID 134893672
[(Z)-2,3-bis(dimethylamino)prop-2-enylidene]-dimethylazanium chloride (PubChem CID 134893672) has the molecular formula C9H20ClN3 and a molecular weight of 205.73 g/mol. Its IUPAC name is [(Z)-2,3-bis(dimethylamino)prop-2-enylidene]-dimethylazanium chloride.
| Compound Name | [(Z)-2,3-bis(dimethylamino)prop-2-enylidene]-dimethylazanium chloride |
|---|---|
| PubChem CID | 134893672 |
| Molecular Formula | C9H20ClN3 |
| Molecular Weight | 205.73 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | [(Z)-2,3-bis(dimethylamino)prop-2-enylidene]-dimethylazanium chloride |
| SMILES | CN(C)/C=C(/C=[N+](C)C)N(C)C.[Cl-] |
| InChI | InChI=1S/C9H20N3.ClH/c1-10(2)7-9(12(5)6)8-11(3)4;/h7-8H,1-6H3;1H/q+1;/p-1 |
| InChIKey | CYCGEORHIZPICS-UHFFFAOYSA-M |
| XLogP | -2.70 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.73 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|