C12H22INO — CID 134893700
2-but-3-enyl-3,4,4,6-tetramethyl-5,6-dihydro-1,3-oxazin-3-ium iodide (PubChem CID 134893700) has the molecular formula C12H22INO and a molecular weight of 323.22 g/mol. Its IUPAC name is 2-but-3-enyl-3,4,4,6-tetramethyl-5,6-dihydro-1,3-oxazin-3-ium iodide.
| Compound Name | 2-but-3-enyl-3,4,4,6-tetramethyl-5,6-dihydro-1,3-oxazin-3-ium iodide |
|---|---|
| PubChem CID | 134893700 |
| Molecular Formula | C12H22INO |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 2-but-3-enyl-3,4,4,6-tetramethyl-5,6-dihydro-1,3-oxazin-3-ium iodide |
| SMILES | C=CCCC1=[N+](C)C(C)(C)CC(C)O1.[I-] |
| InChI | InChI=1S/C12H22NO.HI/c1-6-7-8-11-13(5)12(3,4)9-10(2)14-11;/h6,10H,1,7-9H2,2-5H3;1H/q+1;/p-1 |
| InChIKey | JAGJSBQNBZOTAZ-UHFFFAOYSA-M |
| XLogP | -0.42 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|