About 3-methyl-2-nonyl-4,5-dihydro-1H-imidazol-3-ium iodide
3-methyl-2-nonyl-4,5-dihydro-1H-imidazol-3-ium iodide (PubChem CID 134893751) has the molecular formula C13H27IN2
and a molecular weight of 338.28 g/mol. Its IUPAC name is 3-methyl-2-nonyl-4,5-dihydro-1H-imidazol-3-ium iodide.
Molecular Properties
| Compound Name | 3-methyl-2-nonyl-4,5-dihydro-1H-imidazol-3-ium iodide |
| PubChem CID | 134893751 |
| Molecular Formula | C13H27IN2 |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 3-methyl-2-nonyl-4,5-dihydro-1H-imidazol-3-ium iodide |
| SMILES | CCCCCCCCCC1=[N+](C)CCN1.[I-] |
| InChI | InChI=1S/C13H26N2.HI/c1-3-4-5-6-7-8-9-10-13-14-11-12-15(13)2;/h3-12H2,1-2H3;1H |
| InChIKey | WSJZUSMKYIWTAM-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2-nonyl-4,5-dihydro-1H-imidazol-3-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-nonyl-4,5-dihydro-1H-imidazol-3-ium iodide?
The IUPAC name of 3-methyl-2-nonyl-4,5-dihydro-1H-imidazol-3-ium iodide (CID 134893751) is 3-methyl-2-nonyl-4,5-dihydro-1H-imidazol-3-ium iodide.
What is the SMILES notation for 3-methyl-2-nonyl-4,5-dihydro-1H-imidazol-3-ium iodide?
The canonical SMILES for 3-methyl-2-nonyl-4,5-dihydro-1H-imidazol-3-ium iodide is CCCCCCCCCC1=[N+](C)CCN1.[I-].
What is the InChIKey of 3-methyl-2-nonyl-4,5-dihydro-1H-imidazol-3-ium iodide?
The InChIKey is WSJZUSMKYIWTAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2.HI/c1-3-4-5-6-7-8-9-10-13-14-11-12-15(13)2;/h3-12H2,1-2H3;1H.
What are the key properties of 3-methyl-2-nonyl-4,5-dihydro-1H-imidazol-3-ium iodide?
3-methyl-2-nonyl-4,5-dihydro-1H-imidazol-3-ium iodide has a molecular weight of 338.28 g/mol, XLogP of -0.22, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-nonyl-4,5-dihydro-1H-imidazol-3-ium iodide is sourced from PubChem (CID 134893751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).