C12H22N2O2 — CID 134893821
1-N,1-N,3-N,3-N-tetramethylcyclohexane-1,3-dicarboxamide (PubChem CID 134893821) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-N,1-N,3-N,3-N-tetramethylcyclohexane-1,3-dicarboxamide.
| Compound Name | 1-N,1-N,3-N,3-N-tetramethylcyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 134893821 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1-N,1-N,3-N,3-N-tetramethylcyclohexane-1,3-dicarboxamide |
| SMILES | CN(C)C(=O)C1CCCC(C(=O)N(C)C)C1 |
| InChI | InChI=1S/C12H22N2O2/c1-13(2)11(15)9-6-5-7-10(8-9)12(16)14(3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | LTUYVRNZVVDZEV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |