C14H21FO2S — CID 134893907
1-(1-fluoro-4,4-dimethylpentyl)sulfonyl-4-methylbenzene (PubChem CID 134893907) has the molecular formula C14H21FO2S and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-(1-fluoro-4,4-dimethylpentyl)sulfonyl-4-methylbenzene.
| Compound Name | 1-(1-fluoro-4,4-dimethylpentyl)sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 134893907 |
| Molecular Formula | C14H21FO2S |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1-(1-fluoro-4,4-dimethylpentyl)sulfonyl-4-methylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)C(F)CCC(C)(C)C)cc1 |
| InChI | InChI=1S/C14H21FO2S/c1-11-5-7-12(8-6-11)18(16,17)13(15)9-10-14(2,3)4/h5-8,13H,9-10H2,1-4H3 |
| InChIKey | BDPGZHAHPADLOX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |