About copper(1+);1-(1-hexylselanylethenylselanyl)hexane
copper(1+);1-(1-hexylselanylethenylselanyl)hexane (PubChem CID 134893913) has the molecular formula C14H27CuSe2
and a molecular weight of 416.84 g/mol. Its IUPAC name is copper(1+);1-(1-hexylselanylethenylselanyl)hexane.
Molecular Properties
| Compound Name | copper(1+);1-(1-hexylselanylethenylselanyl)hexane |
| PubChem CID | 134893913 |
| Molecular Formula | C14H27CuSe2 |
| Molecular Weight | 416.84 g/mol |
| Exact Mass | 417.97 |
| IUPAC Name | copper(1+);1-(1-hexylselanylethenylselanyl)hexane |
| SMILES | [Cu+].[H][C-]=C([Se]CCCCCC)[Se]CCCCCC |
| InChI | InChI=1S/C14H27Se2.Cu/c1-4-6-8-10-12-15-14(3)16-13-11-9-7-5-2;/h3H,4-13H2,1-2H3;/q-1;+1 |
| InChIKey | WRKYDHCJBLQVCL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.84 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);1-(1-hexylselanylethenylselanyl)hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);1-(1-hexylselanylethenylselanyl)hexane?
The IUPAC name of copper(1+);1-(1-hexylselanylethenylselanyl)hexane (CID 134893913) is copper(1+);1-(1-hexylselanylethenylselanyl)hexane.
What is the SMILES notation for copper(1+);1-(1-hexylselanylethenylselanyl)hexane?
The canonical SMILES for copper(1+);1-(1-hexylselanylethenylselanyl)hexane is [Cu+].[H][C-]=C([Se]CCCCCC)[Se]CCCCCC.
What is the InChIKey of copper(1+);1-(1-hexylselanylethenylselanyl)hexane?
The InChIKey is WRKYDHCJBLQVCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27Se2.Cu/c1-4-6-8-10-12-15-14(3)16-13-11-9-7-5-2;/h3H,4-13H2,1-2H3;/q-1;+1.
What are the key properties of copper(1+);1-(1-hexylselanylethenylselanyl)hexane?
copper(1+);1-(1-hexylselanylethenylselanyl)hexane has a molecular weight of 416.84 g/mol, XLogP of 4.66, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);1-(1-hexylselanylethenylselanyl)hexane is sourced from PubChem (CID 134893913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).