C12H16O4S — CID 134894017
(E,2R,3S,4R)-6-phenylsulfanylhex-5-ene-1,2,3,4-tetrol (PubChem CID 134894017) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is (E,2R,3S,4R)-6-phenylsulfanylhex-5-ene-1,2,3,4-tetrol.
| Compound Name | (E,2R,3S,4R)-6-phenylsulfanylhex-5-ene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 134894017 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | (E,2R,3S,4R)-6-phenylsulfanylhex-5-ene-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)/C=C/Sc1ccccc1 |
| InChI | InChI=1S/C12H16O4S/c13-8-11(15)12(16)10(14)6-7-17-9-4-2-1-3-5-9/h1-7,10-16H,8H2/b7-6+/t10-,11-,12+/m1/s1 |
| InChIKey | PTBJDTWCNJPZQF-SBMYGGQKSA-N |
| XLogP | 0.37 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |