About (2Z)-3,3-dimethyl-2-(phenylhydrazinylidene)butanenitrile oxide
(2Z)-3,3-dimethyl-2-(phenylhydrazinylidene)butanenitrile oxide (PubChem CID 134894059) has the molecular formula C12H15N3O
and a molecular weight of 217.27 g/mol. Its IUPAC name is (2Z)-3,3-dimethyl-2-(phenylhydrazinylidene)butanenitrile oxide.
Molecular Properties
| Compound Name | (2Z)-3,3-dimethyl-2-(phenylhydrazinylidene)butanenitrile oxide |
| PubChem CID | 134894059 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | (2Z)-3,3-dimethyl-2-(phenylhydrazinylidene)butanenitrile oxide |
| SMILES | CC(C)(C)/C(C#[N+][O-])=N/Nc1ccccc1 |
| InChI | InChI=1S/C12H15N3O/c1-12(2,3)11(9-13-16)15-14-10-7-5-4-6-8-10/h4-8,14H,1-3H3/b15-11+ |
| InChIKey | CVPRRSUYLYGAOM-RVDMUPIBSA-N |
| XLogP | 3.33 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-3,3-dimethyl-2-(phenylhydrazinylidene)butanenitrile oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-3,3-dimethyl-2-(phenylhydrazinylidene)butanenitrile oxide?
The IUPAC name of (2Z)-3,3-dimethyl-2-(phenylhydrazinylidene)butanenitrile oxide (CID 134894059) is (2Z)-3,3-dimethyl-2-(phenylhydrazinylidene)butanenitrile oxide.
What is the SMILES notation for (2Z)-3,3-dimethyl-2-(phenylhydrazinylidene)butanenitrile oxide?
The canonical SMILES for (2Z)-3,3-dimethyl-2-(phenylhydrazinylidene)butanenitrile oxide is CC(C)(C)/C(C#[N+][O-])=N/Nc1ccccc1.
What is the InChIKey of (2Z)-3,3-dimethyl-2-(phenylhydrazinylidene)butanenitrile oxide?
The InChIKey is CVPRRSUYLYGAOM-RVDMUPIBSA-N. The full InChI is InChI=1S/C12H15N3O/c1-12(2,3)11(9-13-16)15-14-10-7-5-4-6-8-10/h4-8,14H,1-3H3/b15-11+.
What are the key properties of (2Z)-3,3-dimethyl-2-(phenylhydrazinylidene)butanenitrile oxide?
(2Z)-3,3-dimethyl-2-(phenylhydrazinylidene)butanenitrile oxide has a molecular weight of 217.27 g/mol, XLogP of 3.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-3,3-dimethyl-2-(phenylhydrazinylidene)butanenitrile oxide is sourced from PubChem (CID 134894059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).