C13H22O5 — CID 134894078
methyl (7E,9E,11S)-5,11-dihydroxy-11-methoxyundeca-7,9-dienoate (PubChem CID 134894078) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is methyl (7E,9E,11S)-5,11-dihydroxy-11-methoxyundeca-7,9-dienoate.
| Compound Name | methyl (7E,9E,11S)-5,11-dihydroxy-11-methoxyundeca-7,9-dienoate |
|---|---|
| PubChem CID | 134894078 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | methyl (7E,9E,11S)-5,11-dihydroxy-11-methoxyundeca-7,9-dienoate |
| SMILES | COC(=O)CCCC(O)C/C=C/C=C/[C@@H](O)OC |
| InChI | InChI=1S/C13H22O5/c1-17-12(15)9-5-3-4-7-11(14)8-6-10-13(16)18-2/h3-5,9,11-12,14-15H,6-8,10H2,1-2H3/b4-3+,9-5+/t11?,12-/m0/s1 |
| InChIKey | ZPKHYSRMLFKVOP-GTWMKYBPSA-N |
| XLogP | 1.16 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|