About CID 134894136
CID 134894136 (PubChem CID 134894136) has the molecular formula C11H17Li
and a molecular weight of 156.20 g/mol.
Molecular Properties
| Compound Name | CID 134894136 |
| PubChem CID | 134894136 |
| Molecular Formula | C11H17Li |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | — |
| SMILES | CC1=[C-]C(C)CC2C1C2(C)C.[Li+] |
| InChI | InChI=1S/C11H17.Li/c1-7-5-8(2)10-9(6-7)11(10,3)4;/h7,9-10H,6H2,1-4H3;/q-1;+1 |
| InChIKey | YSQZJFKHXVDRCI-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 134894136 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134894136?
The IUPAC name of CID 134894136 (CID 134894136) is not available.
What is the SMILES notation for CID 134894136?
The canonical SMILES for CID 134894136 is CC1=[C-]C(C)CC2C1C2(C)C.[Li+].
What is the InChIKey of CID 134894136?
The InChIKey is YSQZJFKHXVDRCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17.Li/c1-7-5-8(2)10-9(6-7)11(10,3)4;/h7,9-10H,6H2,1-4H3;/q-1;+1.
What are the key properties of CID 134894136?
CID 134894136 has a molecular weight of 156.20 g/mol, XLogP of 0.05, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134894136 is sourced from PubChem (CID 134894136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).