C7H5Cl3N2O2 — CID 134894151
5-methyl-1-(1,2,2-trichloroethenyl)pyrimidine-2,4-dione (PubChem CID 134894151) has the molecular formula C7H5Cl3N2O2 and a molecular weight of 255.49 g/mol. Its IUPAC name is 5-methyl-1-(1,2,2-trichloroethenyl)pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-(1,2,2-trichloroethenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134894151 |
| Molecular Formula | C7H5Cl3N2O2 |
| Molecular Weight | 255.49 g/mol |
| Exact Mass | 253.94 |
| IUPAC Name | 5-methyl-1-(1,2,2-trichloroethenyl)pyrimidine-2,4-dione |
| SMILES | Cc1cn(C(Cl)=C(Cl)Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H5Cl3N2O2/c1-3-2-12(5(10)4(8)9)7(14)11-6(3)13/h2H,1H3,(H,11,13,14) |
| InChIKey | HLHAJSSRQBSMQY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.49 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |