C12H16O4 — CID 134894154
methyl (1S,2R,4S)-2-(2-methoxy-2-oxoethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 134894154) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is methyl (1S,2R,4S)-2-(2-methoxy-2-oxoethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | methyl (1S,2R,4S)-2-(2-methoxy-2-oxoethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 134894154 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | methyl (1S,2R,4S)-2-(2-methoxy-2-oxoethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | COC(=O)C[C@]1(C(=O)OC)C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C12H16O4/c1-15-10(13)7-12(11(14)16-2)6-8-3-4-9(12)5-8/h3-4,8-9H,5-7H2,1-2H3/t8-,9+,12+/m0/s1 |
| InChIKey | MLDORSKDIKGXTB-YGOYTEALSA-N |
| XLogP | 1.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|