About 3-oxopentanedioyl dichloride
3-oxopentanedioyl dichloride (PubChem CID 134894189) has the molecular formula C5H4Cl2O3
and a molecular weight of 182.99 g/mol. Its IUPAC name is 3-oxopentanedioyl dichloride.
Molecular Properties
| Compound Name | 3-oxopentanedioyl dichloride |
| PubChem CID | 134894189 |
| Molecular Formula | C5H4Cl2O3 |
| Molecular Weight | 182.99 g/mol |
| Exact Mass | 181.95 |
| IUPAC Name | 3-oxopentanedioyl dichloride |
| SMILES | O=C(Cl)CC(=O)CC(=O)Cl |
| InChI | InChI=1S/C5H4Cl2O3/c6-4(9)1-3(8)2-5(7)10/h1-2H2 |
| InChIKey | DVJXYSPXBNSVSJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.99 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-oxopentanedioyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxopentanedioyl dichloride?
The IUPAC name of 3-oxopentanedioyl dichloride (CID 134894189) is 3-oxopentanedioyl dichloride.
What is the SMILES notation for 3-oxopentanedioyl dichloride?
The canonical SMILES for 3-oxopentanedioyl dichloride is O=C(Cl)CC(=O)CC(=O)Cl.
What is the InChIKey of 3-oxopentanedioyl dichloride?
The InChIKey is DVJXYSPXBNSVSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4Cl2O3/c6-4(9)1-3(8)2-5(7)10/h1-2H2.
What are the key properties of 3-oxopentanedioyl dichloride?
3-oxopentanedioyl dichloride has a molecular weight of 182.99 g/mol, XLogP of 0.87, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxopentanedioyl dichloride is sourced from PubChem (CID 134894189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).