C9H16N2O7 — CID 134894253
N-[(E,3R,4R,5S,6R)-4,5,6,7-tetrahydroxy-1-nitrohept-1-en-3-yl]acetamide (PubChem CID 134894253) has the molecular formula C9H16N2O7 and a molecular weight of 264.23 g/mol. Its IUPAC name is N-[(E,3R,4R,5S,6R)-4,5,6,7-tetrahydroxy-1-nitrohept-1-en-3-yl]acetamide.
| Compound Name | N-[(E,3R,4R,5S,6R)-4,5,6,7-tetrahydroxy-1-nitrohept-1-en-3-yl]acetamide |
|---|---|
| PubChem CID | 134894253 |
| Molecular Formula | C9H16N2O7 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | N-[(E,3R,4R,5S,6R)-4,5,6,7-tetrahydroxy-1-nitrohept-1-en-3-yl]acetamide |
| SMILES | CC(=O)N[C@H](/C=C/[N+](=O)[O-])[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H16N2O7/c1-5(13)10-6(2-3-11(17)18)8(15)9(16)7(14)4-12/h2-3,6-9,12,14-16H,4H2,1H3,(H,10,13)/b3-2+/t6-,7-,8-,9-/m1/s1 |
| InChIKey | NIFFHAMRZFVWAK-AGNFKBHSSA-N |
| XLogP | -2.64 |
| TPSA | 153.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|