C12H27ClO5 — CID 134894267
tritert-butyloxidanium perchlorate (PubChem CID 134894267) has the molecular formula C12H27ClO5 and a molecular weight of 286.80 g/mol. Its IUPAC name is tritert-butyloxidanium perchlorate.
| Compound Name | tritert-butyloxidanium perchlorate |
|---|---|
| PubChem CID | 134894267 |
| Molecular Formula | C12H27ClO5 |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | tritert-butyloxidanium perchlorate |
| SMILES | CC(C)(C)[O+](C(C)(C)C)C(C)(C)C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C12H27O.ClHO4/c1-10(2,3)13(11(4,5)6)12(7,8)9;2-1(3,4)5/h1-9H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | ZNACOZZOXYPJLS-UHFFFAOYSA-M |
| XLogP | -0.82 |
| TPSA | 94.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|