About 1-methyl-2-methylidene-3,4-dihydroisothiochromene-1-carbonitrile
1-methyl-2-methylidene-3,4-dihydroisothiochromene-1-carbonitrile (PubChem CID 134894270) has the molecular formula C12H13NS
and a molecular weight of 203.31 g/mol. Its IUPAC name is 1-methyl-2-methylidene-3,4-dihydroisothiochromene-1-carbonitrile.
Molecular Properties
| Compound Name | 1-methyl-2-methylidene-3,4-dihydroisothiochromene-1-carbonitrile |
| PubChem CID | 134894270 |
| Molecular Formula | C12H13NS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 1-methyl-2-methylidene-3,4-dihydroisothiochromene-1-carbonitrile |
| SMILES | C=S1CCc2ccccc2C1(C)C#N |
| InChI | InChI=1S/C12H13NS/c1-12(9-13)11-6-4-3-5-10(11)7-8-14(12)2/h3-6H,2,7-8H2,1H3 |
| InChIKey | HFGFWNYIMZIBHZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-methylidene-3,4-dihydroisothiochromene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-methylidene-3,4-dihydroisothiochromene-1-carbonitrile?
The IUPAC name of 1-methyl-2-methylidene-3,4-dihydroisothiochromene-1-carbonitrile (CID 134894270) is 1-methyl-2-methylidene-3,4-dihydroisothiochromene-1-carbonitrile.
What is the SMILES notation for 1-methyl-2-methylidene-3,4-dihydroisothiochromene-1-carbonitrile?
The canonical SMILES for 1-methyl-2-methylidene-3,4-dihydroisothiochromene-1-carbonitrile is C=S1CCc2ccccc2C1(C)C#N.
What is the InChIKey of 1-methyl-2-methylidene-3,4-dihydroisothiochromene-1-carbonitrile?
The InChIKey is HFGFWNYIMZIBHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NS/c1-12(9-13)11-6-4-3-5-10(11)7-8-14(12)2/h3-6H,2,7-8H2,1H3.
What are the key properties of 1-methyl-2-methylidene-3,4-dihydroisothiochromene-1-carbonitrile?
1-methyl-2-methylidene-3,4-dihydroisothiochromene-1-carbonitrile has a molecular weight of 203.31 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-methylidene-3,4-dihydroisothiochromene-1-carbonitrile is sourced from PubChem (CID 134894270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).