C14H24OS2 — CID 134894400
(2R,4aS,8aS)-4a-methylspiro[1,2,4,5,6,7,8,8a-octahydronaphthalene-3,2'-1,3-dithiane]-2-ol (PubChem CID 134894400) has the molecular formula C14H24OS2 and a molecular weight of 272.48 g/mol. Its IUPAC name is (2R,4aS,8aS)-4a-methylspiro[1,2,4,5,6,7,8,8a-octahydronaphthalene-3,2'-1,3-dithiane]-2-ol.
| Compound Name | (2R,4aS,8aS)-4a-methylspiro[1,2,4,5,6,7,8,8a-octahydronaphthalene-3,2'-1,3-dithiane]-2-ol |
|---|---|
| PubChem CID | 134894400 |
| Molecular Formula | C14H24OS2 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (2R,4aS,8aS)-4a-methylspiro[1,2,4,5,6,7,8,8a-octahydronaphthalene-3,2'-1,3-dithiane]-2-ol |
| SMILES | C[C@@]12CCCC[C@H]1C[C@@H](O)C1(C2)SCCCS1 |
| InChI | InChI=1S/C14H24OS2/c1-13-6-3-2-5-11(13)9-12(15)14(10-13)16-7-4-8-17-14/h11-12,15H,2-10H2,1H3/t11-,12+,13-/m0/s1 |
| InChIKey | DPWZYRVZXDQIQB-XQQFMLRXSA-N |
| XLogP | 3.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |