methyl (2E)-2-(trimethylsilylmethylimino)acetate

C7H15NO2Si — CID 134894459

IUPACmethyl (2E)-2-(trimethylsilylmethylimino)acetate
SMILESCOC(=O)/C=N/C[Si](C)(C)C
InChIInChI=1S/C7H15NO2Si/c1-10-7(9)5-8-6-11(2,3)4/h5H,6H2,1-4H3/b8-5+
InChIKeyPHLPREBQQMKLFL-VMPITWQZSA-N
MW173.29 g/mol
LogP1.11
Rot. Bonds3

About methyl (2E)-2-(trimethylsilylmethylimino)acetate

methyl (2E)-2-(trimethylsilylmethylimino)acetate (PubChem CID 134894459) has the molecular formula C7H15NO2Si and a molecular weight of 173.29 g/mol. Its IUPAC name is methyl (2E)-2-(trimethylsilylmethylimino)acetate.

Molecular Properties

Compound Namemethyl (2E)-2-(trimethylsilylmethylimino)acetate
PubChem CID134894459
Molecular FormulaC7H15NO2Si
Molecular Weight173.29 g/mol
Exact Mass173.09
IUPAC Namemethyl (2E)-2-(trimethylsilylmethylimino)acetate
SMILESCOC(=O)/C=N/C[Si](C)(C)C
InChIInChI=1S/C7H15NO2Si/c1-10-7(9)5-8-6-11(2,3)4/h5H,6H2,1-4H3/b8-5+
InChIKeyPHLPREBQQMKLFL-VMPITWQZSA-N
XLogP1.11
TPSA38.66 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.29
LogP ≤ 51.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze methyl (2E)-2-(trimethylsilylmethylimino)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2E)-2-(trimethylsilylmethylimino)acetate?
The IUPAC name of methyl (2E)-2-(trimethylsilylmethylimino)acetate (CID 134894459) is methyl (2E)-2-(trimethylsilylmethylimino)acetate.
What is the SMILES notation for methyl (2E)-2-(trimethylsilylmethylimino)acetate?
The canonical SMILES for methyl (2E)-2-(trimethylsilylmethylimino)acetate is COC(=O)/C=N/C[Si](C)(C)C.
What is the InChIKey of methyl (2E)-2-(trimethylsilylmethylimino)acetate?
The InChIKey is PHLPREBQQMKLFL-VMPITWQZSA-N. The full InChI is InChI=1S/C7H15NO2Si/c1-10-7(9)5-8-6-11(2,3)4/h5H,6H2,1-4H3/b8-5+.
What are the key properties of methyl (2E)-2-(trimethylsilylmethylimino)acetate?
methyl (2E)-2-(trimethylsilylmethylimino)acetate has a molecular weight of 173.29 g/mol, XLogP of 1.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2E)-2-(trimethylsilylmethylimino)acetate is sourced from PubChem (CID 134894459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).