About [dimethyl-[(2,4,6-trimethylphenyl)methyl]-λ4-sulfanyl] perchlorate
[dimethyl-[(2,4,6-trimethylphenyl)methyl]-λ4-sulfanyl] perchlorate (PubChem CID 134894574) has the molecular formula C12H19ClO4S
and a molecular weight of 294.80 g/mol. Its IUPAC name is [dimethyl-[(2,4,6-trimethylphenyl)methyl]-λ4-sulfanyl] perchlorate.
Molecular Properties
| Compound Name | [dimethyl-[(2,4,6-trimethylphenyl)methyl]-λ4-sulfanyl] perchlorate |
| PubChem CID | 134894574 |
| Molecular Formula | C12H19ClO4S |
| Molecular Weight | 294.80 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | [dimethyl-[(2,4,6-trimethylphenyl)methyl]-λ4-sulfanyl] perchlorate |
| SMILES | Cc1cc(C)c(CS(C)(C)O[Cl+3]([O-])([O-])[O-])c(C)c1 |
| InChI | InChI=1S/C12H19ClO4S/c1-9-6-10(2)12(11(3)7-9)8-18(4,5)17-13(14,15)16/h6-7H,8H2,1-5H3 |
| InChIKey | ROJPEGJBQYOFLU-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 78.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.80 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [dimethyl-[(2,4,6-trimethylphenyl)methyl]-λ4-sulfanyl] perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethyl-[(2,4,6-trimethylphenyl)methyl]-λ4-sulfanyl] perchlorate?
The IUPAC name of [dimethyl-[(2,4,6-trimethylphenyl)methyl]-λ4-sulfanyl] perchlorate (CID 134894574) is [dimethyl-[(2,4,6-trimethylphenyl)methyl]-λ4-sulfanyl] perchlorate.
What is the SMILES notation for [dimethyl-[(2,4,6-trimethylphenyl)methyl]-λ4-sulfanyl] perchlorate?
The canonical SMILES for [dimethyl-[(2,4,6-trimethylphenyl)methyl]-λ4-sulfanyl] perchlorate is Cc1cc(C)c(CS(C)(C)O[Cl+3]([O-])([O-])[O-])c(C)c1.
What is the InChIKey of [dimethyl-[(2,4,6-trimethylphenyl)methyl]-λ4-sulfanyl] perchlorate?
The InChIKey is ROJPEGJBQYOFLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19ClO4S/c1-9-6-10(2)12(11(3)7-9)8-18(4,5)17-13(14,15)16/h6-7H,8H2,1-5H3.
What are the key properties of [dimethyl-[(2,4,6-trimethylphenyl)methyl]-λ4-sulfanyl] perchlorate?
[dimethyl-[(2,4,6-trimethylphenyl)methyl]-λ4-sulfanyl] perchlorate has a molecular weight of 294.80 g/mol, XLogP of 0.00, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethyl-[(2,4,6-trimethylphenyl)methyl]-λ4-sulfanyl] perchlorate is sourced from PubChem (CID 134894574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).