3,3-dimethylbutane-2-sulfinyl chloride

C6H13ClOS — CID 134894585

IUPAC3,3-dimethylbutane-2-sulfinyl chloride
SMILESCC(S(=O)Cl)C(C)(C)C
InChIInChI=1S/C6H13ClOS/c1-5(9(7)8)6(2,3)4/h5H,1-4H3
InChIKeyUMGIRYGNIINMQB-UHFFFAOYSA-N
MW168.69 g/mol
LogP2.32
Rot. Bonds1

About 3,3-dimethylbutane-2-sulfinyl chloride

3,3-dimethylbutane-2-sulfinyl chloride (PubChem CID 134894585) has the molecular formula C6H13ClOS and a molecular weight of 168.69 g/mol. Its IUPAC name is 3,3-dimethylbutane-2-sulfinyl chloride.

Molecular Properties

Compound Name3,3-dimethylbutane-2-sulfinyl chloride
PubChem CID134894585
Molecular FormulaC6H13ClOS
Molecular Weight168.69 g/mol
Exact Mass168.04
IUPAC Name3,3-dimethylbutane-2-sulfinyl chloride
SMILESCC(S(=O)Cl)C(C)(C)C
InChIInChI=1S/C6H13ClOS/c1-5(9(7)8)6(2,3)4/h5H,1-4H3
InChIKeyUMGIRYGNIINMQB-UHFFFAOYSA-N
XLogP2.32
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.69
LogP ≤ 52.32
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze 3,3-dimethylbutane-2-sulfinyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

CID 60911640
CID 60911640
CID 88004578
CID 88004578
CID 12861209
CID 12861209
CID 134877173
CID 134877173
CID 165749571
CID 165749571
CID 5114906
CID 5114906
CID 17827923
CID 17827923
CID 57213698
CID 57213698
CID 57921046
CID 57921046
CID 71397719
CID 71397719
CID 159212267
CID 159212267
CID 173375116
CID 173375116

Frequently Asked Questions

What is the IUPAC name of 3,3-dimethylbutane-2-sulfinyl chloride?
The IUPAC name of 3,3-dimethylbutane-2-sulfinyl chloride (CID 134894585) is 3,3-dimethylbutane-2-sulfinyl chloride.
What is the SMILES notation for 3,3-dimethylbutane-2-sulfinyl chloride?
The canonical SMILES for 3,3-dimethylbutane-2-sulfinyl chloride is CC(S(=O)Cl)C(C)(C)C.
What is the InChIKey of 3,3-dimethylbutane-2-sulfinyl chloride?
The InChIKey is UMGIRYGNIINMQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13ClOS/c1-5(9(7)8)6(2,3)4/h5H,1-4H3.
What are the key properties of 3,3-dimethylbutane-2-sulfinyl chloride?
3,3-dimethylbutane-2-sulfinyl chloride has a molecular weight of 168.69 g/mol, XLogP of 2.32, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylbutane-2-sulfinyl chloride is sourced from PubChem (CID 134894585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).