C10H20N2S — CID 134894678
(2R,5S)-2,5-ditert-butyl-2,5-dihydro-1,3,4-thiadiazole (PubChem CID 134894678) has the molecular formula C10H20N2S and a molecular weight of 200.35 g/mol. Its IUPAC name is (2R,5S)-2,5-ditert-butyl-2,5-dihydro-1,3,4-thiadiazole.
| Compound Name | (2R,5S)-2,5-ditert-butyl-2,5-dihydro-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 134894678 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (2R,5S)-2,5-ditert-butyl-2,5-dihydro-1,3,4-thiadiazole |
| SMILES | CC(C)(C)[C@@H]1N=N[C@H](C(C)(C)C)S1 |
| InChI | InChI=1S/C10H20N2S/c1-9(2,3)7-11-12-8(13-7)10(4,5)6/h7-8H,1-6H3/t7-,8+ |
| InChIKey | YYXFGWZFLFPBPS-OCAPTIKFSA-N |
| XLogP | 3.93 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |