C12H24O3Si — CID 134894689
trans-methyl (1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclopropane-1-carboxylate (PubChem CID 134894689) has the molecular formula C12H24O3Si and a molecular weight of 244.41 g/mol. Its IUPAC name is trans-methyl (1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclopropane-1-carboxylate.
| Compound Name | trans-methyl (1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 134894689 |
| Molecular Formula | C12H24O3Si |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | trans-methyl (1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@]1(O[Si](C)(C)C(C)(C)C)C[C@H]1C |
| InChI | InChI=1S/C12H24O3Si/c1-9-8-12(9,10(13)14-5)15-16(6,7)11(2,3)4/h9H,8H2,1-7H3/t9-,12+/m1/s1 |
| InChIKey | USHGMLVMIQZLFX-SKDRFNHKSA-N |
| XLogP | 2.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|