About (E)-N,N-dimethyl-2-(1-methyltetrazol-5-yl)ethenamine
(E)-N,N-dimethyl-2-(1-methyltetrazol-5-yl)ethenamine (PubChem CID 134894724) has the molecular formula C6H11N5
and a molecular weight of 153.19 g/mol. Its IUPAC name is (E)-N,N-dimethyl-2-(1-methyltetrazol-5-yl)ethenamine.
Molecular Properties
| Compound Name | (E)-N,N-dimethyl-2-(1-methyltetrazol-5-yl)ethenamine |
| PubChem CID | 134894724 |
| Molecular Formula | C6H11N5 |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | (E)-N,N-dimethyl-2-(1-methyltetrazol-5-yl)ethenamine |
| SMILES | CN(C)/C=C/c1nnnn1C |
| InChI | InChI=1S/C6H11N5/c1-10(2)5-4-6-7-8-9-11(6)3/h4-5H,1-3H3/b5-4+ |
| InChIKey | ORZKUXJIIAPUQA-SNAWJCMRSA-N |
| XLogP | -0.26 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (E)-N,N-dimethyl-2-(1-methyltetrazol-5-yl)ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N-dimethyl-2-(1-methyltetrazol-5-yl)ethenamine?
The IUPAC name of (E)-N,N-dimethyl-2-(1-methyltetrazol-5-yl)ethenamine (CID 134894724) is (E)-N,N-dimethyl-2-(1-methyltetrazol-5-yl)ethenamine.
What is the SMILES notation for (E)-N,N-dimethyl-2-(1-methyltetrazol-5-yl)ethenamine?
The canonical SMILES for (E)-N,N-dimethyl-2-(1-methyltetrazol-5-yl)ethenamine is CN(C)/C=C/c1nnnn1C.
What is the InChIKey of (E)-N,N-dimethyl-2-(1-methyltetrazol-5-yl)ethenamine?
The InChIKey is ORZKUXJIIAPUQA-SNAWJCMRSA-N. The full InChI is InChI=1S/C6H11N5/c1-10(2)5-4-6-7-8-9-11(6)3/h4-5H,1-3H3/b5-4+.
What are the key properties of (E)-N,N-dimethyl-2-(1-methyltetrazol-5-yl)ethenamine?
(E)-N,N-dimethyl-2-(1-methyltetrazol-5-yl)ethenamine has a molecular weight of 153.19 g/mol, XLogP of -0.26, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N-dimethyl-2-(1-methyltetrazol-5-yl)ethenamine is sourced from PubChem (CID 134894724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).