About lithium 5,6-dimethyl-3-methylidene-2-[(2-methylpropan-2-yl)oxymethyl]-4-oxocyclohexa-1,5-dien-1-olate
lithium 5,6-dimethyl-3-methylidene-2-[(2-methylpropan-2-yl)oxymethyl]-4-oxocyclohexa-1,5-dien-1-olate (PubChem CID 134894760) has the molecular formula C14H19LiO3
and a molecular weight of 242.24 g/mol. Its IUPAC name is lithium 5,6-dimethyl-3-methylidene-2-[(2-methylpropan-2-yl)oxymethyl]-4-oxocyclohexa-1,5-dien-1-olate.
Molecular Properties
| Compound Name | lithium 5,6-dimethyl-3-methylidene-2-[(2-methylpropan-2-yl)oxymethyl]-4-oxocyclohexa-1,5-dien-1-olate |
| PubChem CID | 134894760 |
| Molecular Formula | C14H19LiO3 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | lithium 5,6-dimethyl-3-methylidene-2-[(2-methylpropan-2-yl)oxymethyl]-4-oxocyclohexa-1,5-dien-1-olate |
| SMILES | C=C1C(=O)C(C)=C(C)C([O-])=C1COC(C)(C)C.[Li+] |
| InChI | InChI=1S/C14H20O3.Li/c1-8-9(2)13(16)11(10(3)12(8)15)7-17-14(4,5)6;/h16H,3,7H2,1-2,4-6H3;/q;+1/p-1 |
| InChIKey | IZDVMRWALJZQOY-UHFFFAOYSA-M |
| XLogP | -1.10 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze lithium 5,6-dimethyl-3-methylidene-2-[(2-methylpropan-2-yl)oxymethyl]-4-oxocyclohexa-1,5-dien-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 5,6-dimethyl-3-methylidene-2-[(2-methylpropan-2-yl)oxymethyl]-4-oxocyclohexa-1,5-dien-1-olate?
The IUPAC name of lithium 5,6-dimethyl-3-methylidene-2-[(2-methylpropan-2-yl)oxymethyl]-4-oxocyclohexa-1,5-dien-1-olate (CID 134894760) is lithium 5,6-dimethyl-3-methylidene-2-[(2-methylpropan-2-yl)oxymethyl]-4-oxocyclohexa-1,5-dien-1-olate.
What is the SMILES notation for lithium 5,6-dimethyl-3-methylidene-2-[(2-methylpropan-2-yl)oxymethyl]-4-oxocyclohexa-1,5-dien-1-olate?
The canonical SMILES for lithium 5,6-dimethyl-3-methylidene-2-[(2-methylpropan-2-yl)oxymethyl]-4-oxocyclohexa-1,5-dien-1-olate is C=C1C(=O)C(C)=C(C)C([O-])=C1COC(C)(C)C.[Li+].
What is the InChIKey of lithium 5,6-dimethyl-3-methylidene-2-[(2-methylpropan-2-yl)oxymethyl]-4-oxocyclohexa-1,5-dien-1-olate?
The InChIKey is IZDVMRWALJZQOY-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H20O3.Li/c1-8-9(2)13(16)11(10(3)12(8)15)7-17-14(4,5)6;/h16H,3,7H2,1-2,4-6H3;/q;+1/p-1.
What are the key properties of lithium 5,6-dimethyl-3-methylidene-2-[(2-methylpropan-2-yl)oxymethyl]-4-oxocyclohexa-1,5-dien-1-olate?
lithium 5,6-dimethyl-3-methylidene-2-[(2-methylpropan-2-yl)oxymethyl]-4-oxocyclohexa-1,5-dien-1-olate has a molecular weight of 242.24 g/mol, XLogP of -1.10, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 5,6-dimethyl-3-methylidene-2-[(2-methylpropan-2-yl)oxymethyl]-4-oxocyclohexa-1,5-dien-1-olate is sourced from PubChem (CID 134894760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).