About hexafluoroantimony(1-);2-methylbenzenediazonium
hexafluoroantimony(1-);2-methylbenzenediazonium (PubChem CID 134895028) has the molecular formula C7H7F6N2Sb
and a molecular weight of 354.90 g/mol. Its IUPAC name is hexafluoroantimony(1-);2-methylbenzenediazonium.
Molecular Properties
| Compound Name | hexafluoroantimony(1-);2-methylbenzenediazonium |
| PubChem CID | 134895028 |
| Molecular Formula | C7H7F6N2Sb |
| Molecular Weight | 354.90 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | hexafluoroantimony(1-);2-methylbenzenediazonium |
| SMILES | Cc1ccccc1[N+]#N.F[Sb-](F)(F)(F)(F)F |
| InChI | InChI=1S/C7H7N2.6FH.Sb/c1-6-4-2-3-5-7(6)9-8;;;;;;;/h2-5H,1H3;6*1H;/q+1;;;;;;;+5/p-6 |
| InChIKey | JPNJHWKMWLLESB-UHFFFAOYSA-H |
| XLogP | 4.62 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.90 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hexafluoroantimony(1-);2-methylbenzenediazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexafluoroantimony(1-);2-methylbenzenediazonium?
The IUPAC name of hexafluoroantimony(1-);2-methylbenzenediazonium (CID 134895028) is hexafluoroantimony(1-);2-methylbenzenediazonium.
What is the SMILES notation for hexafluoroantimony(1-);2-methylbenzenediazonium?
The canonical SMILES for hexafluoroantimony(1-);2-methylbenzenediazonium is Cc1ccccc1[N+]#N.F[Sb-](F)(F)(F)(F)F.
What is the InChIKey of hexafluoroantimony(1-);2-methylbenzenediazonium?
The InChIKey is JPNJHWKMWLLESB-UHFFFAOYSA-H. The full InChI is InChI=1S/C7H7N2.6FH.Sb/c1-6-4-2-3-5-7(6)9-8;;;;;;;/h2-5H,1H3;6*1H;/q+1;;;;;;;+5/p-6.
What are the key properties of hexafluoroantimony(1-);2-methylbenzenediazonium?
hexafluoroantimony(1-);2-methylbenzenediazonium has a molecular weight of 354.90 g/mol, XLogP of 4.62, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexafluoroantimony(1-);2-methylbenzenediazonium is sourced from PubChem (CID 134895028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).