About 2-(furan-2-yl)-1,3-oxathiane
2-(furan-2-yl)-1,3-oxathiane (PubChem CID 134895251) has the molecular formula C8H10O2S
and a molecular weight of 170.23 g/mol. Its IUPAC name is 2-(furan-2-yl)-1,3-oxathiane.
Molecular Properties
| Compound Name | 2-(furan-2-yl)-1,3-oxathiane |
| PubChem CID | 134895251 |
| Molecular Formula | C8H10O2S |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 2-(furan-2-yl)-1,3-oxathiane |
| SMILES | c1coc(C2OCCCS2)c1 |
| InChI | InChI=1S/C8H10O2S/c1-3-7(9-4-1)8-10-5-2-6-11-8/h1,3-4,8H,2,5-6H2 |
| InChIKey | NLPRHVCGCMHTIB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(furan-2-yl)-1,3-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-2-yl)-1,3-oxathiane?
The IUPAC name of 2-(furan-2-yl)-1,3-oxathiane (CID 134895251) is 2-(furan-2-yl)-1,3-oxathiane.
What is the SMILES notation for 2-(furan-2-yl)-1,3-oxathiane?
The canonical SMILES for 2-(furan-2-yl)-1,3-oxathiane is c1coc(C2OCCCS2)c1.
What is the InChIKey of 2-(furan-2-yl)-1,3-oxathiane?
The InChIKey is NLPRHVCGCMHTIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2S/c1-3-7(9-4-1)8-10-5-2-6-11-8/h1,3-4,8H,2,5-6H2.
What are the key properties of 2-(furan-2-yl)-1,3-oxathiane?
2-(furan-2-yl)-1,3-oxathiane has a molecular weight of 170.23 g/mol, XLogP of 2.43, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-2-yl)-1,3-oxathiane is sourced from PubChem (CID 134895251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).