About (4E)-2-ethoxy-4-ethylhepta-1,4-dien-3-one
(4E)-2-ethoxy-4-ethylhepta-1,4-dien-3-one (PubChem CID 134895517) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is (4E)-2-ethoxy-4-ethylhepta-1,4-dien-3-one.
Molecular Properties
| Compound Name | (4E)-2-ethoxy-4-ethylhepta-1,4-dien-3-one |
| PubChem CID | 134895517 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (4E)-2-ethoxy-4-ethylhepta-1,4-dien-3-one |
| SMILES | C=C(OCC)C(=O)/C(=C/CC)CC |
| InChI | InChI=1S/C11H18O2/c1-5-8-10(6-2)11(12)9(4)13-7-3/h8H,4-7H2,1-3H3/b10-8+ |
| InChIKey | GNZRJBZPLJLHFA-CSKARUKUSA-N |
| XLogP | 2.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4E)-2-ethoxy-4-ethylhepta-1,4-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-2-ethoxy-4-ethylhepta-1,4-dien-3-one?
The IUPAC name of (4E)-2-ethoxy-4-ethylhepta-1,4-dien-3-one (CID 134895517) is (4E)-2-ethoxy-4-ethylhepta-1,4-dien-3-one.
What is the SMILES notation for (4E)-2-ethoxy-4-ethylhepta-1,4-dien-3-one?
The canonical SMILES for (4E)-2-ethoxy-4-ethylhepta-1,4-dien-3-one is C=C(OCC)C(=O)/C(=C/CC)CC.
What is the InChIKey of (4E)-2-ethoxy-4-ethylhepta-1,4-dien-3-one?
The InChIKey is GNZRJBZPLJLHFA-CSKARUKUSA-N. The full InChI is InChI=1S/C11H18O2/c1-5-8-10(6-2)11(12)9(4)13-7-3/h8H,4-7H2,1-3H3/b10-8+.
What are the key properties of (4E)-2-ethoxy-4-ethylhepta-1,4-dien-3-one?
(4E)-2-ethoxy-4-ethylhepta-1,4-dien-3-one has a molecular weight of 182.26 g/mol, XLogP of 2.85, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-2-ethoxy-4-ethylhepta-1,4-dien-3-one is sourced from PubChem (CID 134895517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).