About Te-[(Z)-2-(2,6-dichlorophenyl)ethenyl] N,N-dimethylcarbamotelluroate
Te-[(Z)-2-(2,6-dichlorophenyl)ethenyl] N,N-dimethylcarbamotelluroate (PubChem CID 134895571) has the molecular formula C11H11Cl2NOTe
and a molecular weight of 371.72 g/mol. Its IUPAC name is Te-[(Z)-2-(2,6-dichlorophenyl)ethenyl] N,N-dimethylcarbamotelluroate.
Molecular Properties
| Compound Name | Te-[(Z)-2-(2,6-dichlorophenyl)ethenyl] N,N-dimethylcarbamotelluroate |
| PubChem CID | 134895571 |
| Molecular Formula | C11H11Cl2NOTe |
| Molecular Weight | 371.72 g/mol |
| Exact Mass | 372.93 |
| IUPAC Name | Te-[(Z)-2-(2,6-dichlorophenyl)ethenyl] N,N-dimethylcarbamotelluroate |
| SMILES | CN(C)C(=O)[Te]/C=C\c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H11Cl2NOTe/c1-14(2)11(15)16-7-6-8-9(12)4-3-5-10(8)13/h3-7H,1-2H3/b7-6- |
| InChIKey | IQFGAHPEIWMHAO-SREVYHEPSA-N |
| XLogP | 3.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.72 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Te-[(Z)-2-(2,6-dichlorophenyl)ethenyl] N,N-dimethylcarbamotelluroate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Te-[(Z)-2-(2,6-dichlorophenyl)ethenyl] N,N-dimethylcarbamotelluroate?
The IUPAC name of Te-[(Z)-2-(2,6-dichlorophenyl)ethenyl] N,N-dimethylcarbamotelluroate (CID 134895571) is Te-[(Z)-2-(2,6-dichlorophenyl)ethenyl] N,N-dimethylcarbamotelluroate.
What is the SMILES notation for Te-[(Z)-2-(2,6-dichlorophenyl)ethenyl] N,N-dimethylcarbamotelluroate?
The canonical SMILES for Te-[(Z)-2-(2,6-dichlorophenyl)ethenyl] N,N-dimethylcarbamotelluroate is CN(C)C(=O)[Te]/C=C\c1c(Cl)cccc1Cl.
What is the InChIKey of Te-[(Z)-2-(2,6-dichlorophenyl)ethenyl] N,N-dimethylcarbamotelluroate?
The InChIKey is IQFGAHPEIWMHAO-SREVYHEPSA-N. The full InChI is InChI=1S/C11H11Cl2NOTe/c1-14(2)11(15)16-7-6-8-9(12)4-3-5-10(8)13/h3-7H,1-2H3/b7-6-.
What are the key properties of Te-[(Z)-2-(2,6-dichlorophenyl)ethenyl] N,N-dimethylcarbamotelluroate?
Te-[(Z)-2-(2,6-dichlorophenyl)ethenyl] N,N-dimethylcarbamotelluroate has a molecular weight of 371.72 g/mol, XLogP of 3.35, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Te-[(Z)-2-(2,6-dichlorophenyl)ethenyl] N,N-dimethylcarbamotelluroate is sourced from PubChem (CID 134895571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).