About 1-methoxy-2-methyl-2,3-dihydro-1-benzothiophen-1-ium tetrafluoroborate
1-methoxy-2-methyl-2,3-dihydro-1-benzothiophen-1-ium tetrafluoroborate (PubChem CID 134895710) has the molecular formula C10H13BF4OS
and a molecular weight of 268.08 g/mol. Its IUPAC name is 1-methoxy-2-methyl-2,3-dihydro-1-benzothiophen-1-ium tetrafluoroborate.
Molecular Properties
| Compound Name | 1-methoxy-2-methyl-2,3-dihydro-1-benzothiophen-1-ium tetrafluoroborate |
| PubChem CID | 134895710 |
| Molecular Formula | C10H13BF4OS |
| Molecular Weight | 268.08 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 1-methoxy-2-methyl-2,3-dihydro-1-benzothiophen-1-ium tetrafluoroborate |
| SMILES | CO[S+]1c2ccccc2CC1C.F[B-](F)(F)F |
| InChI | InChI=1S/C10H13OS.BF4/c1-8-7-9-5-3-4-6-10(9)12(8)11-2;2-1(3,4)5/h3-6,8H,7H2,1-2H3;/q+1;-1 |
| InChIKey | YMYIWZQBDYVWDE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.08 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-2-methyl-2,3-dihydro-1-benzothiophen-1-ium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2-methyl-2,3-dihydro-1-benzothiophen-1-ium tetrafluoroborate?
The IUPAC name of 1-methoxy-2-methyl-2,3-dihydro-1-benzothiophen-1-ium tetrafluoroborate (CID 134895710) is 1-methoxy-2-methyl-2,3-dihydro-1-benzothiophen-1-ium tetrafluoroborate.
What is the SMILES notation for 1-methoxy-2-methyl-2,3-dihydro-1-benzothiophen-1-ium tetrafluoroborate?
The canonical SMILES for 1-methoxy-2-methyl-2,3-dihydro-1-benzothiophen-1-ium tetrafluoroborate is CO[S+]1c2ccccc2CC1C.F[B-](F)(F)F.
What is the InChIKey of 1-methoxy-2-methyl-2,3-dihydro-1-benzothiophen-1-ium tetrafluoroborate?
The InChIKey is YMYIWZQBDYVWDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13OS.BF4/c1-8-7-9-5-3-4-6-10(9)12(8)11-2;2-1(3,4)5/h3-6,8H,7H2,1-2H3;/q+1;-1.
What are the key properties of 1-methoxy-2-methyl-2,3-dihydro-1-benzothiophen-1-ium tetrafluoroborate?
1-methoxy-2-methyl-2,3-dihydro-1-benzothiophen-1-ium tetrafluoroborate has a molecular weight of 268.08 g/mol, XLogP of 3.47, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2-methyl-2,3-dihydro-1-benzothiophen-1-ium tetrafluoroborate is sourced from PubChem (CID 134895710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).