About butylazanium;N-butylsulfamate
butylazanium;N-butylsulfamate (PubChem CID 134895769) has the molecular formula C8H22N2O3S
and a molecular weight of 226.34 g/mol. Its IUPAC name is butylazanium;N-butylsulfamate.
Molecular Properties
| Compound Name | butylazanium;N-butylsulfamate |
| PubChem CID | 134895769 |
| Molecular Formula | C8H22N2O3S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | butylazanium;N-butylsulfamate |
| SMILES | CCCCNS(=O)(=O)[O-].CCCC[NH3+] |
| InChI | InChI=1S/C4H11NO3S.C4H11N/c1-2-3-4-5-9(6,7)8;1-2-3-4-5/h5H,2-4H2,1H3,(H,6,7,8);2-5H2,1H3 |
| InChIKey | SJHAPUSRGSHPHZ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze butylazanium;N-butylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylazanium;N-butylsulfamate?
The IUPAC name of butylazanium;N-butylsulfamate (CID 134895769) is butylazanium;N-butylsulfamate.
What is the SMILES notation for butylazanium;N-butylsulfamate?
The canonical SMILES for butylazanium;N-butylsulfamate is CCCCNS(=O)(=O)[O-].CCCC[NH3+].
What is the InChIKey of butylazanium;N-butylsulfamate?
The InChIKey is SJHAPUSRGSHPHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO3S.C4H11N/c1-2-3-4-5-9(6,7)8;1-2-3-4-5/h5H,2-4H2,1H3,(H,6,7,8);2-5H2,1H3.
What are the key properties of butylazanium;N-butylsulfamate?
butylazanium;N-butylsulfamate has a molecular weight of 226.34 g/mol, XLogP of -0.14, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butylazanium;N-butylsulfamate is sourced from PubChem (CID 134895769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).