C9H18O3 — CID 134895800
(1R)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentane-1,4-diol (PubChem CID 134895800) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is (1R)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentane-1,4-diol.
| Compound Name | (1R)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentane-1,4-diol |
|---|---|
| PubChem CID | 134895800 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | (1R)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentane-1,4-diol |
| SMILES | CC(C)(O)CC[C@@H](O)[C@@]1(C)CO1 |
| InChI | InChI=1S/C9H18O3/c1-8(2,11)5-4-7(10)9(3)6-12-9/h7,10-11H,4-6H2,1-3H3/t7-,9-/m1/s1 |
| InChIKey | WFIQUCUVQZAZEE-VXNVDRBHSA-N |
| XLogP | 0.69 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|