About (5E)-5-methyl-7-[(2E)-3-methylhepta-2,6-dienyl]sulfanylhepta-1,5-diene
(5E)-5-methyl-7-[(2E)-3-methylhepta-2,6-dienyl]sulfanylhepta-1,5-diene (PubChem CID 134895802) has the molecular formula C16H26S
and a molecular weight of 250.45 g/mol. Its IUPAC name is (5E)-5-methyl-7-[(2E)-3-methylhepta-2,6-dienyl]sulfanylhepta-1,5-diene.
Molecular Properties
| Compound Name | (5E)-5-methyl-7-[(2E)-3-methylhepta-2,6-dienyl]sulfanylhepta-1,5-diene |
| PubChem CID | 134895802 |
| Molecular Formula | C16H26S |
| Molecular Weight | 250.45 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | (5E)-5-methyl-7-[(2E)-3-methylhepta-2,6-dienyl]sulfanylhepta-1,5-diene |
| SMILES | C=CCC/C(C)=C/CSC/C=C(\C)CCC=C |
| InChI | InChI=1S/C16H26S/c1-5-7-9-15(3)11-13-17-14-12-16(4)10-8-6-2/h5-6,11-12H,1-2,7-10,13-14H2,3-4H3/b15-11+,16-12+ |
| InChIKey | ROAGEQZLFUJSNM-JOBJLJCHSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-5-methyl-7-[(2E)-3-methylhepta-2,6-dienyl]sulfanylhepta-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-methyl-7-[(2E)-3-methylhepta-2,6-dienyl]sulfanylhepta-1,5-diene?
The IUPAC name of (5E)-5-methyl-7-[(2E)-3-methylhepta-2,6-dienyl]sulfanylhepta-1,5-diene (CID 134895802) is (5E)-5-methyl-7-[(2E)-3-methylhepta-2,6-dienyl]sulfanylhepta-1,5-diene.
What is the SMILES notation for (5E)-5-methyl-7-[(2E)-3-methylhepta-2,6-dienyl]sulfanylhepta-1,5-diene?
The canonical SMILES for (5E)-5-methyl-7-[(2E)-3-methylhepta-2,6-dienyl]sulfanylhepta-1,5-diene is C=CCC/C(C)=C/CSC/C=C(\C)CCC=C.
What is the InChIKey of (5E)-5-methyl-7-[(2E)-3-methylhepta-2,6-dienyl]sulfanylhepta-1,5-diene?
The InChIKey is ROAGEQZLFUJSNM-JOBJLJCHSA-N. The full InChI is InChI=1S/C16H26S/c1-5-7-9-15(3)11-13-17-14-12-16(4)10-8-6-2/h5-6,11-12H,1-2,7-10,13-14H2,3-4H3/b15-11+,16-12+.
What are the key properties of (5E)-5-methyl-7-[(2E)-3-methylhepta-2,6-dienyl]sulfanylhepta-1,5-diene?
(5E)-5-methyl-7-[(2E)-3-methylhepta-2,6-dienyl]sulfanylhepta-1,5-diene has a molecular weight of 250.45 g/mol, XLogP of 5.54, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-methyl-7-[(2E)-3-methylhepta-2,6-dienyl]sulfanylhepta-1,5-diene is sourced from PubChem (CID 134895802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).