C13H23ClO — CID 134895836
(1R,2S)-5-chloro-1-cyclohexyl-2-ethenylpentan-1-ol (PubChem CID 134895836) has the molecular formula C13H23ClO and a molecular weight of 230.78 g/mol. Its IUPAC name is (1R,2S)-5-chloro-1-cyclohexyl-2-ethenylpentan-1-ol.
| Compound Name | (1R,2S)-5-chloro-1-cyclohexyl-2-ethenylpentan-1-ol |
|---|---|
| PubChem CID | 134895836 |
| Molecular Formula | C13H23ClO |
| Molecular Weight | 230.78 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (1R,2S)-5-chloro-1-cyclohexyl-2-ethenylpentan-1-ol |
| SMILES | C=C[C@H](CCCCl)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C13H23ClO/c1-2-11(9-6-10-14)13(15)12-7-4-3-5-8-12/h2,11-13,15H,1,3-10H2/t11-,13+/m1/s1 |
| InChIKey | SLOUEAJPUYWVNA-YPMHNXCESA-N |
| XLogP | 3.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.78 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|