C11H18HgO4 — CID 134895920
[(1S)-1-carboxylato-1-[(2S,3S,5R)-6-methoxy-3,5-dimethyloxan-2-yl]ethyl]mercury(1+) (PubChem CID 134895920) has the molecular formula C11H18HgO4 and a molecular weight of 414.85 g/mol. Its IUPAC name is [(1S)-1-carboxylato-1-[(2S,3S,5R)-6-methoxy-3,5-dimethyloxan-2-yl]ethyl]mercury(1+).
| Compound Name | [(1S)-1-carboxylato-1-[(2S,3S,5R)-6-methoxy-3,5-dimethyloxan-2-yl]ethyl]mercury(1+) |
|---|---|
| PubChem CID | 134895920 |
| Molecular Formula | C11H18HgO4 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | [(1S)-1-carboxylato-1-[(2S,3S,5R)-6-methoxy-3,5-dimethyloxan-2-yl]ethyl]mercury(1+) |
| SMILES | COC1O[C@H]([C@](C)([Hg+])C(=O)[O-])[C@@H](C)C[C@H]1C |
| InChI | InChI=1S/C11H19O4.Hg/c1-6-5-7(2)11(14-4)15-9(6)8(3)10(12)13;/h6-7,9,11H,5H2,1-4H3,(H,12,13);/q;+1/p-1/t6-,7+,9-,11?;/m0./s1 |
| InChIKey | CGEUQBRDDJCZLX-HKHSQYJDSA-M |
| XLogP | 0.50 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|