C14H27NO — CID 134895925
(E,3R)-N,N,3-trimethylundec-4-enamide (PubChem CID 134895925) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is (E,3R)-N,N,3-trimethylundec-4-enamide.
| Compound Name | (E,3R)-N,N,3-trimethylundec-4-enamide |
|---|---|
| PubChem CID | 134895925 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | (E,3R)-N,N,3-trimethylundec-4-enamide |
| SMILES | CCCCCC/C=C/[C@H](C)CC(=O)N(C)C |
| InChI | InChI=1S/C14H27NO/c1-5-6-7-8-9-10-11-13(2)12-14(16)15(3)4/h10-11,13H,5-9,12H2,1-4H3/b11-10+/t13-/m0/s1 |
| InChIKey | SLDAABPNPHCDJF-NHAQELONSA-N |
| XLogP | 3.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|