About 3-methoxydodec-1-ene
3-methoxydodec-1-ene (PubChem CID 134895994) has the molecular formula C13H26O
and a molecular weight of 198.35 g/mol. Its IUPAC name is 3-methoxydodec-1-ene.
Molecular Properties
| Compound Name | 3-methoxydodec-1-ene |
| PubChem CID | 134895994 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | 3-methoxydodec-1-ene |
| SMILES | C=CC(CCCCCCCCC)OC |
| InChI | InChI=1S/C13H26O/c1-4-6-7-8-9-10-11-12-13(5-2)14-3/h5,13H,2,4,6-12H2,1,3H3 |
| InChIKey | ZUDRIPQIHZFWIY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxydodec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxydodec-1-ene?
The IUPAC name of 3-methoxydodec-1-ene (CID 134895994) is 3-methoxydodec-1-ene.
What is the SMILES notation for 3-methoxydodec-1-ene?
The canonical SMILES for 3-methoxydodec-1-ene is C=CC(CCCCCCCCC)OC.
What is the InChIKey of 3-methoxydodec-1-ene?
The InChIKey is ZUDRIPQIHZFWIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O/c1-4-6-7-8-9-10-11-12-13(5-2)14-3/h5,13H,2,4,6-12H2,1,3H3.
What are the key properties of 3-methoxydodec-1-ene?
3-methoxydodec-1-ene has a molecular weight of 198.35 g/mol, XLogP of 4.33, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxydodec-1-ene is sourced from PubChem (CID 134895994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).