About ethyl 3-but-3-enyl-1,2-oxazole-5-carboxylate
ethyl 3-but-3-enyl-1,2-oxazole-5-carboxylate (PubChem CID 134896000) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is ethyl 3-but-3-enyl-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-but-3-enyl-1,2-oxazole-5-carboxylate |
| PubChem CID | 134896000 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | ethyl 3-but-3-enyl-1,2-oxazole-5-carboxylate |
| SMILES | C=CCCc1cc(C(=O)OCC)on1 |
| InChI | InChI=1S/C10H13NO3/c1-3-5-6-8-7-9(14-11-8)10(12)13-4-2/h3,7H,1,4-6H2,2H3 |
| InChIKey | RVQZGKCSGJZXIW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-but-3-enyl-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-but-3-enyl-1,2-oxazole-5-carboxylate?
The IUPAC name of ethyl 3-but-3-enyl-1,2-oxazole-5-carboxylate (CID 134896000) is ethyl 3-but-3-enyl-1,2-oxazole-5-carboxylate.
What is the SMILES notation for ethyl 3-but-3-enyl-1,2-oxazole-5-carboxylate?
The canonical SMILES for ethyl 3-but-3-enyl-1,2-oxazole-5-carboxylate is C=CCCc1cc(C(=O)OCC)on1.
What is the InChIKey of ethyl 3-but-3-enyl-1,2-oxazole-5-carboxylate?
The InChIKey is RVQZGKCSGJZXIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c1-3-5-6-8-7-9(14-11-8)10(12)13-4-2/h3,7H,1,4-6H2,2H3.
What are the key properties of ethyl 3-but-3-enyl-1,2-oxazole-5-carboxylate?
ethyl 3-but-3-enyl-1,2-oxazole-5-carboxylate has a molecular weight of 195.22 g/mol, XLogP of 1.97, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-but-3-enyl-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 134896000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).