About triethylazanium;2-trimethylsilylethanesulfonate
triethylazanium;2-trimethylsilylethanesulfonate (PubChem CID 134896062) has the molecular formula C11H29NO3SSi
and a molecular weight of 283.51 g/mol. Its IUPAC name is triethylazanium;2-trimethylsilylethanesulfonate.
Molecular Properties
| Compound Name | triethylazanium;2-trimethylsilylethanesulfonate |
| PubChem CID | 134896062 |
| Molecular Formula | C11H29NO3SSi |
| Molecular Weight | 283.51 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | triethylazanium;2-trimethylsilylethanesulfonate |
| SMILES | CC[NH+](CC)CC.C[Si](C)(C)CCS(=O)(=O)[O-] |
| InChI | InChI=1S/C6H15N.C5H14O3SSi/c1-4-7(5-2)6-3;1-10(2,3)5-4-9(6,7)8/h4-6H2,1-3H3;4-5H2,1-3H3,(H,6,7,8) |
| InChIKey | ZPOZKMCVXXBPTC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.51 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze triethylazanium;2-trimethylsilylethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethylazanium;2-trimethylsilylethanesulfonate?
The IUPAC name of triethylazanium;2-trimethylsilylethanesulfonate (CID 134896062) is triethylazanium;2-trimethylsilylethanesulfonate.
What is the SMILES notation for triethylazanium;2-trimethylsilylethanesulfonate?
The canonical SMILES for triethylazanium;2-trimethylsilylethanesulfonate is CC[NH+](CC)CC.C[Si](C)(C)CCS(=O)(=O)[O-].
What is the InChIKey of triethylazanium;2-trimethylsilylethanesulfonate?
The InChIKey is ZPOZKMCVXXBPTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C5H14O3SSi/c1-4-7(5-2)6-3;1-10(2,3)5-4-9(6,7)8/h4-6H2,1-3H3;4-5H2,1-3H3,(H,6,7,8).
What are the key properties of triethylazanium;2-trimethylsilylethanesulfonate?
triethylazanium;2-trimethylsilylethanesulfonate has a molecular weight of 283.51 g/mol, XLogP of 0.80, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethylazanium;2-trimethylsilylethanesulfonate is sourced from PubChem (CID 134896062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).