About 4-chloro-4,4-difluoro-1-[(R)-(4-methylphenyl)sulfinyl]butan-2-one
4-chloro-4,4-difluoro-1-[(R)-(4-methylphenyl)sulfinyl]butan-2-one (PubChem CID 134896093) has the molecular formula C11H11ClF2O2S
and a molecular weight of 280.72 g/mol. Its IUPAC name is 4-chloro-4,4-difluoro-1-[(R)-(4-methylphenyl)sulfinyl]butan-2-one.
Molecular Properties
| Compound Name | 4-chloro-4,4-difluoro-1-[(R)-(4-methylphenyl)sulfinyl]butan-2-one |
| PubChem CID | 134896093 |
| Molecular Formula | C11H11ClF2O2S |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 4-chloro-4,4-difluoro-1-[(R)-(4-methylphenyl)sulfinyl]butan-2-one |
| SMILES | Cc1ccc([S@](=O)CC(=O)CC(F)(F)Cl)cc1 |
| InChI | InChI=1S/C11H11ClF2O2S/c1-8-2-4-10(5-3-8)17(16)7-9(15)6-11(12,13)14/h2-5H,6-7H2,1H3/t17-/m1/s1 |
| InChIKey | RLZJLMQAKPRNAJ-QGZVFWFLSA-N |
| XLogP | 2.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-4,4-difluoro-1-[(R)-(4-methylphenyl)sulfinyl]butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-4,4-difluoro-1-[(R)-(4-methylphenyl)sulfinyl]butan-2-one?
The IUPAC name of 4-chloro-4,4-difluoro-1-[(R)-(4-methylphenyl)sulfinyl]butan-2-one (CID 134896093) is 4-chloro-4,4-difluoro-1-[(R)-(4-methylphenyl)sulfinyl]butan-2-one.
What is the SMILES notation for 4-chloro-4,4-difluoro-1-[(R)-(4-methylphenyl)sulfinyl]butan-2-one?
The canonical SMILES for 4-chloro-4,4-difluoro-1-[(R)-(4-methylphenyl)sulfinyl]butan-2-one is Cc1ccc([S@](=O)CC(=O)CC(F)(F)Cl)cc1.
What is the InChIKey of 4-chloro-4,4-difluoro-1-[(R)-(4-methylphenyl)sulfinyl]butan-2-one?
The InChIKey is RLZJLMQAKPRNAJ-QGZVFWFLSA-N. The full InChI is InChI=1S/C11H11ClF2O2S/c1-8-2-4-10(5-3-8)17(16)7-9(15)6-11(12,13)14/h2-5H,6-7H2,1H3/t17-/m1/s1.
What are the key properties of 4-chloro-4,4-difluoro-1-[(R)-(4-methylphenyl)sulfinyl]butan-2-one?
4-chloro-4,4-difluoro-1-[(R)-(4-methylphenyl)sulfinyl]butan-2-one has a molecular weight of 280.72 g/mol, XLogP of 2.89, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-4,4-difluoro-1-[(R)-(4-methylphenyl)sulfinyl]butan-2-one is sourced from PubChem (CID 134896093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).