About zinc;carbanide;2-methylprop-1-ene
zinc;carbanide;2-methylprop-1-ene (PubChem CID 134896142) has the molecular formula C5H10Zn
and a molecular weight of 135.53 g/mol. Its IUPAC name is zinc;carbanide;2-methylprop-1-ene.
Molecular Properties
| Compound Name | zinc;carbanide;2-methylprop-1-ene |
|---|
| PubChem CID | 134896142 |
|---|
| Molecular Formula | C5H10Zn |
|---|
| Molecular Weight | 135.53 g/mol |
|---|
| Exact Mass | 134.01 |
|---|
| IUPAC Name | zinc;carbanide;2-methylprop-1-ene |
|---|
| SMILES | [CH3-].[H][C-]=C(C)C.[Zn+2] |
|---|
| InChI | InChI=1S/C4H7.CH3.Zn/c1-4(2)3;;/h1H,2-3H3;1H3;/q2*-1;+2 |
|---|
| InChIKey | VOUQNKRIZDJDDB-UHFFFAOYSA-N |
|---|
| XLogP | 1.83 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 6 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 135.53 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;carbanide;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;carbanide;2-methylprop-1-ene?
The IUPAC name of zinc;carbanide;2-methylprop-1-ene (CID 134896142) is zinc;carbanide;2-methylprop-1-ene.
What is the SMILES notation for zinc;carbanide;2-methylprop-1-ene?
The canonical SMILES for zinc;carbanide;2-methylprop-1-ene is [CH3-].[H][C-]=C(C)C.[Zn+2].
What is the InChIKey of zinc;carbanide;2-methylprop-1-ene?
The InChIKey is VOUQNKRIZDJDDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7.CH3.Zn/c1-4(2)3;;/h1H,2-3H3;1H3;/q2*-1;+2.
What are the key properties of zinc;carbanide;2-methylprop-1-ene?
zinc;carbanide;2-methylprop-1-ene has a molecular weight of 135.53 g/mol, XLogP of 1.83, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;carbanide;2-methylprop-1-ene is sourced from PubChem (CID 134896142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).