About 1-(5-tert-butyl-1,2-oxazol-3-yl)-5-hydroxy-3-methylimidazolidine-2,4-dione
1-(5-tert-butyl-1,2-oxazol-3-yl)-5-hydroxy-3-methylimidazolidine-2,4-dione (PubChem CID 13489641) has the molecular formula C11H15N3O4
and a molecular weight of 253.26 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-5-hydroxy-3-methylimidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-5-hydroxy-3-methylimidazolidine-2,4-dione |
| PubChem CID | 13489641 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-5-hydroxy-3-methylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)C(O)N(c2cc(C(C)(C)C)on2)C1=O |
| InChI | InChI=1S/C11H15N3O4/c1-11(2,3)6-5-7(12-18-6)14-9(16)8(15)13(4)10(14)17/h5,9,16H,1-4H3 |
| InChIKey | RDURRBIZELFFJB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-tert-butyl-1,2-oxazol-3-yl)-5-hydroxy-3-methylimidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-tert-butyl-1,2-oxazol-3-yl)-5-hydroxy-3-methylimidazolidine-2,4-dione?
The IUPAC name of 1-(5-tert-butyl-1,2-oxazol-3-yl)-5-hydroxy-3-methylimidazolidine-2,4-dione (CID 13489641) is 1-(5-tert-butyl-1,2-oxazol-3-yl)-5-hydroxy-3-methylimidazolidine-2,4-dione.
What is the SMILES notation for 1-(5-tert-butyl-1,2-oxazol-3-yl)-5-hydroxy-3-methylimidazolidine-2,4-dione?
The canonical SMILES for 1-(5-tert-butyl-1,2-oxazol-3-yl)-5-hydroxy-3-methylimidazolidine-2,4-dione is CN1C(=O)C(O)N(c2cc(C(C)(C)C)on2)C1=O.
What is the InChIKey of 1-(5-tert-butyl-1,2-oxazol-3-yl)-5-hydroxy-3-methylimidazolidine-2,4-dione?
The InChIKey is RDURRBIZELFFJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O4/c1-11(2,3)6-5-7(12-18-6)14-9(16)8(15)13(4)10(14)17/h5,9,16H,1-4H3.
What are the key properties of 1-(5-tert-butyl-1,2-oxazol-3-yl)-5-hydroxy-3-methylimidazolidine-2,4-dione?
1-(5-tert-butyl-1,2-oxazol-3-yl)-5-hydroxy-3-methylimidazolidine-2,4-dione has a molecular weight of 253.26 g/mol, XLogP of 0.69, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-tert-butyl-1,2-oxazol-3-yl)-5-hydroxy-3-methylimidazolidine-2,4-dione is sourced from PubChem (CID 13489641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).